CymitQuimica logo

CAS 18052-76-1

:

1-Naphthyltrimethoxysilane

Description:
1-Naphthyltrimethoxysilane, with the CAS number 18052-76-1, is an organosilicon compound characterized by the presence of a naphthyl group attached to a trimethoxysilane moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its ability to act as a coupling agent, enhancing the adhesion between organic materials and inorganic substrates. Its structure features a silicon atom bonded to three methoxy groups and one naphthyl group, which contributes to its unique chemical properties. 1-Naphthyltrimethoxysilane is often utilized in various applications, including surface modification, coatings, and as a precursor in the synthesis of hybrid organic-inorganic materials. The methoxy groups can undergo hydrolysis and condensation reactions, allowing the compound to form siloxane networks upon exposure to moisture. This property makes it valuable in the development of durable and water-resistant materials. Additionally, its aromatic naphthyl group can impart specific optical or electronic properties, making it of interest in advanced material science and nanotechnology.
Formula:C13H16O3Si
InChI:InChI=1/C13H16O3Si/c1-14-17(15-2,16-3)13-10-6-8-11-7-4-5-9-12(11)13/h4-10H,1-3H3
InChI key:ZSOVVFMGSCDMIF-UHFFFAOYSA-N
SMILES:CO[Si](c1cccc2ccccc12)(OC)OC
Synonyms:
  • Trimethoxy(Naphthalen-1-Yl)Silane
Found 5 products.