CymitQuimica logo

CAS 180692-27-7

:

Methanesulfonic acid, trifluoro-, 1,2,3,6-tetrahydro-1-methyl-4-pyridinylester

Description:
Methanesulfonic acid, trifluoro-, 1,2,3,6-tetrahydro-1-methyl-4-pyridinyl ester, identified by CAS number 180692-27-7, is a chemical compound characterized by its unique structure that includes a pyridine ring and a methanesulfonic acid moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid, with a relatively low boiling point and moderate solubility in polar solvents like water and alcohols. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various biologically active compounds. The trifluoromethyl group contributes to its chemical reactivity and stability, making it useful in various chemical reactions. Additionally, the presence of the tetrahydro-pyridine structure may impart specific pharmacological properties, enhancing its utility in medicinal chemistry. Safety data should be consulted for handling, as with many chemical substances, it may pose health risks if not managed properly.
Formula:C7H10F3NO3S
InChI:InChI=1S/C7H10F3NO3S/c1-11-4-2-6(3-5-11)14-15(12,13)7(8,9)10/h2H,3-5H2,1H3
InChI key:VLJCJEJRGHGDMQ-UHFFFAOYSA-N
SMILES:CN1CCC(=CC1)OS(=O)(=O)C(F)(F)F
Found 5 products.