
CAS 180790-91-4
:2-(Ethylthio)-4-pyridinecarbonitrile
Description:
2-(Ethylthio)-4-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the ethylthio group introduces a sulfur atom into the structure, contributing to its unique chemical properties. This compound features a cyano group (-C≡N) attached to the pyridine ring, which enhances its reactivity and potential applications in various chemical reactions. Typically, compounds like this exhibit moderate to high polarity due to the electronegative nitrogen and sulfur atoms, influencing their solubility in polar solvents. The presence of the cyano group can also impart significant biological activity, making such compounds of interest in medicinal chemistry and agrochemicals. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 2-(Ethylthio)-4-pyridinecarbonitrile is a versatile compound with potential applications in pharmaceuticals and material science.
Formula:C8H8N2S
InChI:InChI=1S/C8H8N2S/c1-2-11-8-5-7(6-9)3-4-10-8/h3-5H,2H2,1H3
InChI key:InChIKey=YIXCRLIMMDUTFV-UHFFFAOYSA-N
SMILES:S(CC)C1=CC(C#N)=CC=N1
Synonyms:- 4-Pyridinecarbonitrile, 2-(ethylthio)-
- 2-(Ethylthio)isonicotinonitrile
- 2-(Ethylsulfanyl)pyridine-4-carbonitrile
- 2-(Ethylthio)-4-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
