CymitQuimica logo

CAS 180975-66-0

:

tert-butyl (2R,6S)-2,6-dimethylpiperazine-1-carboxylate

Description:
Tert-butyl (2R,6S)-2,6-dimethylpiperazine-1-carboxylate is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The specific stereochemistry indicated by the (2R,6S) notation suggests that the compound has defined spatial arrangements at the second and sixth carbon positions, contributing to its potential biological activity and interactions. The tert-butyl group enhances the lipophilicity of the molecule, which can influence its solubility and permeability in biological systems. The carboxylate functional group indicates that the compound can participate in various chemical reactions, including esterification and amidation. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug design and development. Additionally, its CAS number, 180975-66-0, allows for easy identification and retrieval of information regarding its properties, safety data, and applications in scientific literature. Overall, the unique combination of functional groups and stereochemistry makes this compound a subject of interest in various chemical and pharmaceutical research contexts.
Formula:C11H22N2O2
InChI:InChI=1/C11H22N2O2/c1-8-6-12-7-9(2)13(8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3/t8-,9+
InChI key:RBOGBIZGALIITO-DTORHVGOSA-N
SMILES:C[C@@H]1CNC[C@@H](N1C(=O)OC(C)(C)C)C
Synonyms:
  • tert-Butyl (2R,6S)-2,6-dimethylpiperazine-1-carboxylate
Found 4 products.