CymitQuimica logo

CAS 181308-57-6

:

Tert-Butyl Trans-4-Formylcyclohexylcarbamate

Description:
Tert-Butyl trans-4-formylcyclohexylcarbamate is a chemical compound characterized by its unique structural features, which include a tert-butyl group, a trans-configured formyl group attached to a cyclohexane ring, and a carbamate functional group. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the formyl group, which can participate in various chemical reactions, including nucleophilic additions. The carbamate moiety may also influence its stability and reactivity, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. The compound's specific physical properties, such as melting point, boiling point, and spectral characteristics, would depend on its purity and the conditions under which it is studied. Overall, tert-Butyl trans-4-formylcyclohexylcarbamate represents a versatile structure that could be utilized in various chemical syntheses and applications.
Formula:C12H21NO3
InChI:InChI=1S/C12H21NO3/c1-12(2,3)16-11(15)13-10-6-4-9(8-14)5-7-10/h8-10H,4-7H2,1-3H3,(H,13,15)
InChI key:GPDBIGSFXXKWQR-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1CCC(CC1)C=O
Synonyms:
  • Carbamic acid, N-(trans-4-formylcyclohexyl)-,1,1-dimethylethyl ester
Found 6 products.