CAS 181632-25-7
:6-Chloro-2,3-dihydro-5-methyl-N-[6-[(2-methyl-3-pyridinyl)oxy]-3-pyridinyl]-1H-indole-1-carboxamide
Description:
6-Chloro-2,3-dihydro-5-methyl-N-[6-[(2-methyl-3-pyridinyl)oxy]-3-pyridinyl]-1H-indole-1-carboxamide, with CAS number 181632-25-7, is a synthetic organic compound that belongs to the class of indole derivatives. This compound features a complex structure characterized by the presence of an indole ring, which is a bicyclic structure composed of a benzene ring fused to a pyrrole ring. The presence of chlorine and methyl groups contributes to its unique chemical properties, while the pyridinyl and carboxamide functionalities enhance its potential biological activity. Typically, such compounds may exhibit pharmacological properties, making them of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on its functional groups and the overall molecular structure. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. As with many compounds in this category, understanding its interactions and mechanisms of action would be crucial for potential applications in drug development or other fields.
Formula:C21H19ClN4O2
InChI:InChI=1S/C21H19ClN4O2/c1-13-10-15-7-9-26(18(15)11-17(13)22)21(27)25-16-5-6-20(24-12-16)28-19-4-3-8-23-14(19)2/h3-6,8,10-12H,7,9H2,1-2H3,(H,25,27)
InChI key:InChIKey=GIUZEIJUFOPTMR-UHFFFAOYSA-N
SMILES:C(NC=1C=CC(OC2=C(C)N=CC=C2)=NC1)(=O)N3C=4C(CC3)=CC(C)=C(Cl)C4
Synonyms:- 1H-Indole-1-carboxamide, 6-chloro-2,3-dihydro-5-methyl-N-[6-[(2-methyl-3-pyridinyl)oxy]-3-pyridinyl]-
- 6-Chloro-2,3-dihydro-5-methyl-N-[6-[(2-methyl-3-pyridinyl)oxy]-3-pyridinyl]-1H-indole-1-carboxamide
- 6-Chloro-2,3-dihydro-5-methyl-N-[6-[(2-methyl-3-pyridinyl)oxy]-3-pyridinyl]-1H-indole-1-carboxyamide dihydrochloride
- 6-Chloro-5-methyl-1-[(2-[2-methylpyrid-3-yloxy]pyrid-5yl)carbamoyl]indoline dihydrochloride
- SB242084 diHCl
- SB242084 hydrate dihydrochloride
- Sb 242084
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Indole-1-carboxamide, 6-chloro-2,3-dihydro-5-methyl-N-[6-[(2-methyl-3-pyridinyl)oxy]-3-pyridinyl]-
CAS:Formula:C21H19ClN4O2Purity:95%Color and Shape:SolidMolecular weight:394.8542SB 242084 dihydrochloride hydrate
CAS:Formula:C21H19ClN4O2·2HCl·xH2OMolecular weight:467.78 (anhydrous)SB 242084
CAS:SB 242084 dihydrochloride hydrate is a psychoactive drug and research chemical which acts as a selective antagonist for the 5HT2C receptor.Formula:C21H19ClN4O2Purity:99.75% - ≥98%Color and Shape:SolidMolecular weight:394.85SB 242084
CAS:Controlled ProductApplications SB 242084 is a 5-HT2C receptor antagonist that displays 158- and 100-fold selectivity over 5-HT2A and 5-HT2B receptors respectively. SB 242084 displays selectivity over a range of other 5-HT, dopamine and adrenergic receptors.SB 242084 os a brain penetrant; exerts anxiolytic-like activity.
References Bromidge, et al.: J. Med. Chem., 40, 3494 (1997), Kennet, et al.: Neuropharmacology, 36, 609 (1997), Dalton, et al.: Psychopharmacology, 185, 45 (2006),Formula:C21H19ClN4O2·2ClHColor and Shape:NeatMolecular weight:467.78





