CymitQuimica logo

CAS 1820674-09-6

:

1-(1,1-Dimethylethyl) 17-methyl 5,8,11,14-tetraoxa-2-azaheptadecanedioate

Description:
1-(1,1-Dimethylethyl) 17-methyl 5,8,11,14-tetraoxa-2-azaheptadecanedioate, identified by its CAS number 1820674-09-6, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups. This compound features a long carbon chain, with a total of 17 carbon atoms, and incorporates both ether and amide linkages due to the presence of tetraoxa and aza groups. The tert-butyl group (1,1-dimethylethyl) contributes to its steric bulk, potentially influencing its reactivity and solubility. The presence of multiple oxygen atoms suggests that it may exhibit polar characteristics, which could affect its interactions in various chemical environments. Additionally, the compound's structure indicates potential applications in fields such as pharmaceuticals or materials science, where specific functional properties are desirable. However, detailed information regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data or further literature review for comprehensive understanding.
Formula:C17H33NO8
InChI:InChI=1S/C17H33NO8/c1-17(2,3)26-16(20)18-6-8-23-10-12-25-14-13-24-11-9-22-7-5-15(19)21-4/h5-14H2,1-4H3,(H,18,20)
InChI key:InChIKey=AAAYNHLOIFCSJR-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOCCC(OC)=O)NC(OC(C)(C)C)=O
Synonyms:
  • 5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 1-(1,1-dimethylethyl) 17-methyl ester
  • 1-(1,1-Dimethylethyl) 17-methyl 5,8,11,14-tetraoxa-2-azaheptadecanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.