CAS 182210-71-5
:((3R,5R)-5-(2,4difluorophenyl)-5-(iodomethyl)tetrahydrofuran-3-yl)methanol
Description:
The chemical substance with the name "((3R,5R)-5-(2,4-difluorophenyl)-5-(iodomethyl)tetrahydrofuran-3-yl)methanol" and CAS number 182210-71-5 is characterized by its complex molecular structure, which includes a tetrahydrofuran ring, a difluorophenyl group, and an iodomethyl substituent. This compound features stereocenters at the 3 and 5 positions of the tetrahydrofuran, contributing to its chirality and potentially influencing its biological activity and interactions. The presence of the difluorophenyl moiety suggests that it may exhibit unique electronic properties, while the iodomethyl group can enhance reactivity, making it a candidate for various chemical transformations. Additionally, the hydroxymethyl group indicates that the compound may participate in hydrogen bonding, affecting its solubility and reactivity in different solvents. Overall, this substance may have applications in medicinal chemistry or materials science, depending on its specific properties and reactivity patterns.
Formula:C12H13F2IO2
InChI:InChI=1S/C12H13F2IO2/c13-9-1-2-10(11(14)3-9)12(7-15)4-8(5-16)6-17-12/h1-3,8,16H,4-7H2/t8-,12+/m1/s1
InChI key:LBIQKAGCCORVET-PELKAZGASA-N
SMILES:C1[C@@H](CO[C@@]1(CI)C2=C(C=C(C=C2)F)F)CO
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
