CymitQuimica logo

CAS 18222-17-8

:

3-METHYL-5-NITROISOQUINOLINE

Description:
3-Methyl-5-nitroisoquinoline is an organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methyl group at the 3-position and a nitro group at the 5-position contributes to its unique chemical properties. This compound typically appears as a yellow to orange crystalline solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its bioactive properties. It is soluble in organic solvents but has limited solubility in water. The nitro group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit specific biological activities, which are of interest in research related to cancer and other diseases. As with many nitro compounds, it is essential to handle 3-methyl-5-nitroisoquinoline with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C10H8N2O2
InChI:InChI=1/C10H8N2O2/c1-7-5-9-8(6-11-7)3-2-4-10(9)12(13)14/h2-6H,1H3
InChI key:ACENGYNMIBHPKD-UHFFFAOYSA-N
SMILES:Cc1cc2c(cccc2N(=O)=O)cn1
Synonyms:
  • 3-Methy1-5-Lisoquinoline
Found 2 products.