CAS 18228-43-8
:4-Chloro-α-cyclopropylbenzenemethanol
Description:
4-Chloro-α-cyclopropylbenzenemethanol, with the CAS number 18228-43-8, is an organic compound characterized by its unique structure that includes a chlorinated aromatic ring and a cyclopropyl group. This compound features a hydroxymethyl group (-CH2OH) attached to a cyclopropyl-substituted benzene, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chlorine atom enhances its electrophilic properties, making it a useful intermediate in various chemical reactions. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic aromatic components. The cyclopropyl group can impart strain and influence the compound's reactivity, potentially leading to interesting chemical behavior. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H11ClO
InChI:InChI=1S/C10H11ClO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7,10,12H,1-2H2
InChI key:InChIKey=CLKPSDBTSRWVOQ-UHFFFAOYSA-N
SMILES:C(O)(C1CC1)C2=CC=C(Cl)C=C2
Synonyms:- (4-Chlorophenyl)(Cyclopropyl)Methanol
- 4-Chloro-α-cyclopropylbenzenemethanol
- Benzenemethanol, 4-chloro-α-cyclopropyl-
- Benzyl alcohol, p-chloro-α-cyclopropyl-
- 4-Chloro-alpha-cyclopropylbenzyl alcohol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Chloro-α-cyclopropylbenzenemethanol
CAS:Formula:C10H11ClOColor and Shape:LiquidMolecular weight:182.64674-Chloro-α-cyclopropylbenzenemethanol
CAS:4-Chloro-α-cyclopropylbenzenemethanolFormula:C10H11ClOMolecular weight:182.65


