CymitQuimica logo

CAS 18229-30-6

:

9,10-Octadecanedione

Description:
9,10-Octadecanedione, with the CAS number 18229-30-6, is a long-chain aliphatic diketone characterized by its two carbonyl (C=O) functional groups located at the 9th and 10th carbon positions of an 18-carbon saturated fatty acid chain. This compound is typically a solid at room temperature and is known for its waxy texture and relatively high melting point compared to shorter-chain diketones. It is insoluble in water but soluble in organic solvents such as ethanol, ether, and chloroform. 9,10-Octadecanedione is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of surfactants, lubricants, and as a precursor for other chemical compounds. Its unique structure allows for interesting reactivity, making it a subject of study in the context of fatty acid derivatives and their biological implications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C18H34O2
InChI:InChI=1S/C18H34O2/c1-3-5-7-9-11-13-15-17(19)18(20)16-14-12-10-8-6-4-2/h3-16H2,1-2H3
InChI key:YSDLVQIOIXINJC-UHFFFAOYSA-N
SMILES:CCCCCCCCC(=O)C(=O)CCCCCCCC
Found 4 products.