CAS 182295-26-7
:1,2,4-Oxadiazole, 3-(4-methylphenyl)-5-propyl-
Description:
1,2,4-Oxadiazole, 3-(4-methylphenyl)-5-propyl- is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring structure. This compound features a propyl group and a para-methylphenyl substituent, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the oxadiazole moiety often imparts interesting biological and pharmacological activities, making such compounds of interest in medicinal chemistry. Additionally, the specific arrangement of substituents can influence the compound's reactivity, stability, and potential applications in various fields, including materials science and drug development. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact can vary based on the specific structure and functional groups present.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c1-3-4-11-13-12(14-15-11)10-7-5-9(2)6-8-10/h5-8H,3-4H2,1-2H3
InChI key:AKMOYSDZOWQHDU-UHFFFAOYSA-N
SMILES:CCCC1=NC(=NO1)C2=CC=C(C=C2)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
