CAS 1823183-35-2

6-Amino-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2(1H)-pyrimidinethione

Description:

6-Amino-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2(1H)-pyrimidinethione is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and a pyridine moiety. The presence of an amino group and a thione functional group contributes to its potential reactivity and biological activity. The trifluoromethyl group enhances lipophilicity and may influence the compound's pharmacokinetic properties. The chlorine substituent on the pyridine ring can also affect the compound's electronic properties and reactivity. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. As with many heterocyclic compounds, the solubility, stability, and reactivity can vary significantly based on environmental conditions and the presence of other functional groups. Proper handling and safety measures should be observed due to the presence of halogenated and sulfur-containing groups, which may pose health and environmental risks.

Formula: C₁₀H₆ClF₃N₄S

InChI: InChI=1S/C10H6ClF3N4S/c11-6-1-4(10(12,13)14)2-16-7(6)5-3-17-9(19)18-8(5)15/h1-3H,(H3,15,17,18,19)

InChI key: InChIKey=KPFWMUDFPQUENM-UHFFFAOYSA-N

SMILES: ClC1=C(N=CC(C(F)(F)F)=C1)C2=C(N)NC(=S)N=C2

Synonyms:

• 2(1H)-Pyrimidinethione, 6-amino-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-
• 6-Amino-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2(1H)-pyrimidinethione

4-Amino-5-(3-chloro-5-(trifluoromethyl)pyridin-2-yl)pyrimidine-2-thiol

CAS: 1823183-35-2

4-Amino-5-(3-chloro-5-(trifluoromethyl)pyridin-2-yl)pyrimidine-2-thiol

Formula: C₁₀H₆ClF₃N₄S

Purity: 95%

Molecular weight: 306.7

Ref: 54-PC1008435