CAS 182344-16-7
:4-Fluoro-2-(trifluoromethyl)benzeneboronic acid
Description:
4-Fluoro-2-(trifluoromethyl)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a fluorinated aromatic ring. This compound features a fluorine atom at the para position and a trifluoromethyl group at the ortho position relative to the boronic acid moiety. The presence of the boronic acid group imparts unique reactivity, making it useful in various organic synthesis applications, particularly in Suzuki coupling reactions, which are pivotal in forming carbon-carbon bonds. The trifluoromethyl group enhances the compound's lipophilicity and can influence its electronic properties, potentially affecting its reactivity and interaction with biological systems. Additionally, the fluorine substituents can improve the compound's stability and solubility in organic solvents. Overall, 4-Fluoro-2-(trifluoromethyl)benzeneboronic acid is a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals, showcasing the versatility of boronic acids in modern chemistry.
Formula:C7H5BF4O2
InChI:InChI=1S/C7H5BF4O2/c9-4-1-2-6(8(13)14)5(3-4)7(10,11)12/h1-3,13-14H
InChI key:InChIKey=SWUPLEAGZOKLNX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(B(O)O)C=CC(F)=C1
Synonyms:- (4-Fluoro-2-trifluoromethylphenyl)boronic acid
- 4-Fluoro-2-(trifluoromethyl)phenylboronic acid
- Akos Brn-1027
- B-[4-Fluoro-2-(trifluoromethyl)phenyl]boronic acid
- Boronic acid, B-[4-fluoro-2-(trifluoromethyl)phenyl]-
- Boronic acid, [4-fluoro-2-(trifluoromethyl)phenyl]-
- [4-Fluoro-2-(Trifluoromethyl)Phenyl]Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Fluoro-2-(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H5BF4O2Purity:97.0 to 110.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:207.92Boronic acid, B-[4-fluoro-2-(trifluoromethyl)phenyl]-
CAS:Formula:C7H5BF4O2Purity:96%Color and Shape:SolidMolecular weight:207.91804-Fluoro-2-(trifluoromethyl)benzeneboronic acid
CAS:4-Fluoro-2-(trifluoromethyl)benzeneboronic acidPurity:98%Molecular weight:207.92g/mol4-Fluoro-2-(trifluoromethyl)benzeneboronic acid
CAS:Formula:C7H5BF4O2Purity:96%Color and Shape:Solid, Off-white powderMolecular weight:207.924-Fluoro-2-(trifluoromethyl)phenylboronic acid
CAS:The process development of 4-fluoro-2-(trifluoromethyl)phenylboronic acid (4FTFPBA) is a simplified procedure that can be scaled up and used for medicinal chemistry. This compound was synthesized by a boronic acid process using the Suzuki-Miyaura cross coupling reaction. The major factor to consider in this synthesis is the placement of the fluorine atom, which determines the relative reactivity and stability of the compound. In order to mimic these factors, an environment with low water content and a sequence that minimizes exposure to air are required.
Formula:C7H5BF4O2Purity:Min. 95%Color and Shape:PowderMolecular weight:207.92 g/mol





