CymitQuimica logo

CAS 182370-58-7

:

(2R)-1-[(1S)-1-Phenylethyl]-2-aziridinecarboxaldehyde

Description:
(2R)-1-[(1S)-1-Phenylethyl]-2-aziridinecarboxaldehyde is a chiral compound characterized by its aziridine ring, which is a three-membered cyclic amine. The presence of the aldehyde functional group contributes to its reactivity, making it a valuable intermediate in organic synthesis. The compound exhibits stereochemistry, with specific configurations at the aziridine and phenylethyl substituents, which can influence its biological activity and interactions. Typically, compounds like this may be used in the synthesis of pharmaceuticals or as building blocks in complex organic molecules due to their unique structural features. The aziridine ring can participate in various chemical reactions, including ring-opening reactions, which can lead to the formation of more complex structures. Additionally, the phenylethyl group may impart specific properties such as hydrophobicity, affecting solubility and interaction with biological systems. Overall, (2R)-1-[(1S)-1-Phenylethyl]-2-aziridinecarboxaldehyde is notable for its potential applications in medicinal chemistry and its role in asymmetric synthesis.
Formula:C11H13NO
InChI:InChI=1S/C11H13NO/c1-9(12-7-11(12)8-13)10-5-3-2-4-6-10/h2-6,8-9,11H,7H2,1H3/t9-,11+,12?/m0/s1
InChI key:InChIKey=FSEPAAIMOIHFQW-WKAHHKJFSA-N
SMILES:[C@@H](C)(N1[C@@H](C=O)C1)C2=CC=CC=C2
Synonyms:
  • 2-Aziridinecarboxaldehyde, 1-(1-phenylethyl)-, [S-(R*,S*)]-
  • 2-Aziridinecarboxaldehyde, 1-[(1S)-1-phenylethyl]-, (2R)-
  • (2R)-1-[(1S)-1-Phenylethyl]-2-aziridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.