CymitQuimica logo

CAS 1823921-18-1

:

4,7-Dichloro-2-methylthieno[3,2-d]pyrimidine

Description:
4,7-Dichloro-2-methylthieno[3,2-d]pyrimidine is a heterocyclic compound characterized by its fused thieno and pyrimidine rings, which contribute to its unique chemical properties. This compound features two chlorine atoms at the 4 and 7 positions and a methyl group at the 2 position of the pyrimidine ring. The presence of chlorine substituents enhances its reactivity and potential for forming various derivatives, making it of interest in medicinal chemistry and agrochemical applications. The thieno[3,2-d]pyrimidine structure is known for its biological activity, often exhibiting properties such as antimicrobial or antitumor effects. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in drug formulation. Additionally, the compound's molecular structure allows for potential interactions with biological targets, making it a candidate for further research in pharmacology. Overall, 4,7-Dichloro-2-methylthieno[3,2-d]pyrimidine represents a significant class of compounds with diverse applications in chemical and pharmaceutical research.
Formula:C7H4Cl2N2S
InChI:InChI=1S/C7H4Cl2N2S/c1-3-10-5-4(8)2-12-6(5)7(9)11-3/h2H,1H3
InChI key:InChIKey=XTWXLRGSYBNCTP-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(C)=N1)C(Cl)=CS2
Synonyms:
  • Thieno[3,2-d]pyrimidine, 4,7-dichloro-2-methyl-
  • 4,7-Dichloro-2-methylthieno[3,2-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.