CymitQuimica logo

CAS 1824349-18-9

:

2-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-pyrrolidinyl)-1,3-thiazole-4-carboxylic acid

Description:
2-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-pyrrolidinyl)-1,3-thiazole-4-carboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a thiazole ring, a carboxylic acid functional group, and a pyrrolidine moiety. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The compound features an ester linkage due to the presence of the 2-methyl-2-propanyl group, which may influence its solubility and reactivity. The carboxylic acid group is likely to impart acidic properties, making it soluble in polar solvents. Additionally, the compound's stereochemistry, particularly around the pyrrolidine ring, may affect its interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical determination or literature reference for precise values.
Formula:C13H18N2O4S
InChI:InChI=1S/C13H18N2O4S/c1-13(2,3)19-12(18)15-6-4-5-9(15)10-14-8(7-20-10)11(16)17/h7,9H,4-6H2,1-3H3,(H,16,17)
InChI key:DPLVJSMBNOUIIM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCC1C2=NC(=CS2)C(=O)O
Found 2 products.