CymitQuimica logo

CAS 182496-55-5

:

4-TERT-BUTYLTHIACALIX[4]ARENE

Description:
4-tert-Butylthiacalix[4]arene is a synthetic compound belonging to the calixarene family, characterized by its unique cyclic structure composed of four phenolic units linked by sulfur atoms. This compound typically exhibits a cone or partial cone conformation, which is crucial for its ability to selectively bind cations and anions due to the presence of the tert-butyl groups that enhance solubility and steric hindrance. The thiacalix[4]arene framework allows for the formation of host-guest complexes, making it valuable in supramolecular chemistry and applications such as ion-selective sensors, drug delivery systems, and separation processes. Its chemical properties include moderate thermal stability and solubility in organic solvents, which facilitate its use in various chemical reactions and applications. Additionally, the presence of sulfur in the structure can impart unique electronic properties, enhancing its reactivity and interaction with other chemical species. Overall, 4-tert-butylthiacalix[4]arene is a versatile compound with significant potential in both research and industrial applications.
Formula:C40H48O4S4
InChI:InChI=1/C40H48O4S4/c1-37(2,3)21-13-25-33(41)26(14-21)46-28-16-23(39(7,8)9)18-30(35(28)43)48-32-20-24(40(10,11)12)19-31(36(32)44)47-29-17-22(38(4,5)6)15-27(45-25)34(29)42/h13-20,41-44H,1-12H3
InChI key:PDEJSTNRUYUEQL-UHFFFAOYSA-N
SMILES:CC(C)(C)c1cc2c(c(c1)Sc1cc(cc(c1O)Sc1cc(cc(c1O)Sc1cc(cc(c1O)S2)C(C)(C)C)C(C)(C)C)C(C)(C)C)O
Synonyms:
  • Tetra-Tert-Butyl(Tetrahydroxy)Tetrathiacalix[4]Arene
  • 5,11,17,23-Tetra-Tert-Butyl-2,8,14,20-Tetrathiapentacyclo[19.3.1.1~3,7~.1~9,13~.1~15,19~]Octacosa-1(25),3(28),4,6,9(27),10,12,15(26),16,18,21,23-Dodecaene-25,26,27,28-Tetrol
Found 5 products.