CymitQuimica logo

CAS 1826-19-3

:

4-(4-Methylphenyl)thiazole

Description:
4-(4-Methylphenyl)thiazole, with the CAS number 1826-19-3, is an organic compound characterized by a thiazole ring substituted with a para-methylphenyl group. This compound features a five-membered heterocyclic structure containing both sulfur and nitrogen atoms, which contributes to its unique chemical properties. It typically appears as a solid at room temperature and is known for its aromatic characteristics due to the presence of the phenyl group. The thiazole moiety is often associated with biological activity, making this compound of interest in medicinal chemistry and material science. Its solubility can vary depending on the solvent, and it may exhibit fluorescence or other optical properties. Additionally, 4-(4-Methylphenyl)thiazole can participate in various chemical reactions, including electrophilic substitutions and nucleophilic additions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H9NS
InChI:InChI=1S/C10H9NS/c1-8-2-4-9(5-3-8)10-6-12-7-11-10/h2-7H,1H3
InChI key:InChIKey=KHTXVFJHWRJTOR-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C2=CSC=N2
Synonyms:
  • 4-(p-Tolyl)thiazole
  • Thiazole, 4-p-tolyl-
  • Thiazole, 4-(4-methylphenyl)-
  • 4-(4-Methylphenyl)thiazole
Found 4 products.