CymitQuimica logo

CAS 18266-33-6

:

Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 2,3-bis(2-oxiranylmethyl) ester

Description:
Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 2,3-bis(2-oxiranylmethyl) ester, commonly referred to by its CAS number 18266-33-6, is an organic compound characterized by its bicyclic structure, which includes a heptene framework. This compound features two carboxylic acid groups that contribute to its reactivity and potential for forming esters. The presence of bis(2-oxiranylmethyl) groups indicates that it contains epoxide functionalities, which are known for their ability to undergo ring-opening reactions, making the compound useful in various chemical syntheses and applications. The bicyclic nature of the compound imparts unique steric and electronic properties, influencing its behavior in chemical reactions. It is typically used in organic synthesis and may serve as an intermediate in the production of more complex molecules. Additionally, the compound's structure suggests potential applications in materials science, particularly in the development of polymers or resins due to the reactivity of the epoxide groups. Overall, this compound exemplifies the intersection of structural complexity and functional versatility in organic chemistry.
Formula:C15H18O6
InChI:InChI=1S/C15H18O6/c16-14(20-6-10-4-18-10)12-8-1-2-9(3-8)13(12)15(17)21-7-11-5-19-11/h1-2,8-13H,3-7H2
InChI key:InChIKey=LSELIYBTFJVUSX-UHFFFAOYSA-N
SMILES:C(OCC1CO1)(=O)C2C(C(OCC3CO3)=O)C4CC2C=C4
Synonyms:
  • 5-Norbornene-2,3-dicarboxylic acid, bis(2,3-epoxypropyl) ester
  • Diglycidyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
  • 1-Propanol, 2,3-epoxy-, 5-norbornene-2,3-dicarboxylate (2:1)
  • Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, bis(oxiranylmethyl) ester
  • Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid, 2,3-bis(2-oxiranylmethyl) ester
Found 1 products.