CymitQuimica logo

CAS 182683-50-7

:

L-Threonine, L-a-glutamyl-L-alanyl-L-valyl-L-seryl-L-leucyl-L-lysyl-L-prolyl-

Description:
L-Threonine, L-α-glutamyl-L-alanyl-L-valyl-L-seryl-L-leucyl-L-lysyl-L-prolyl- is a synthetic peptide composed of multiple amino acids, specifically L-threonine and several other L-amino acids. This compound is characterized by its sequence of amino acids, which contributes to its structural and functional properties. Peptides like this one are typically involved in various biological processes, including protein synthesis and cellular signaling. The presence of multiple L-amino acids suggests that it may exhibit specific interactions with biological receptors or enzymes. Additionally, the CAS number 182683-50-7 indicates that this substance is cataloged for reference in chemical databases, facilitating its identification in research and industrial applications. Peptides can vary in solubility, stability, and reactivity based on their amino acid composition and sequence, which can influence their potential uses in pharmaceuticals, biotechnology, and nutritional supplements. Overall, this compound exemplifies the complexity and diversity of peptide chemistry in biological systems.
Formula:C37H65N9O13
InChI:InChI=1S/C37H65N9O13/c1-18(2)16-24(32(53)41-23(10-7-8-14-38)36(57)46-15-9-11-26(46)34(55)45-29(21(6)48)37(58)59)42-33(54)25(17-47)43-35(56)28(19(3)4)44-30(51)20(5)40-31(52)22(39)12-13-27(49)50/h18-26,28-29,47-48H,7-17,38-39H2,1-6H3,(H,40,52)(H,41,53)(H,42,54)(H,43,56)(H,44,51)(H,45,55)(H,49,50)(H,58,59)/t20-,21+,22-,23-,24-,25-,26-,28-,29-/m0/s1
InChI key:KNTBAGOTDJPUJV-XMTFRXHISA-N
SMILES:C[C@H]([C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(=O)O)N)O
Found 4 products.