CymitQuimica logo

CAS 1829-60-3

:

7-Oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, dimethylester

Description:
7-Oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid, dimethyl ester, known by its CAS number 1829-60-3, is a bicyclic compound characterized by its unique structural framework that includes a diene system and two carboxylic acid ester functional groups. This compound typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents such as methanol and ethanol, but may have limited solubility in water due to its hydrophobic bicyclic structure. The presence of the ester groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and hydrolysis. Additionally, the bicyclic nature of the compound can impart interesting properties related to its stability and reactivity, which may be exploited in synthetic organic chemistry. Its applications may extend to fields such as pharmaceuticals, agrochemicals, and materials science, where its unique structure can be utilized for the development of novel compounds or intermediates.
Formula:C10H10O5
InChI:InChI=1S/C10H10O5/c1-13-9(11)7-5-3-4-6(15-5)8(7)10(12)14-2/h3-6H,1-2H3
InChI key:FQVSHUVBNGSEJO-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C2C=CC1O2)C(=O)OC
Found 3 products.