CymitQuimica logo

CAS 18293-54-4

:

1-Trimethylsilyl-1,2,4-triazole

Description:
1-Trimethylsilyl-1,2,4-triazole is a chemical compound characterized by its unique structure, which includes a triazole ring substituted with a trimethylsilyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its stability and solubility in organic solvents, making it useful in various chemical applications, particularly in organic synthesis and as a reagent in the preparation of other chemical compounds. The presence of the trimethylsilyl group enhances its reactivity and can influence its interaction with other molecules, often serving as a protecting group in synthetic chemistry. Additionally, 1-Trimethylsilyl-1,2,4-triazole may exhibit properties such as moderate volatility and low toxicity, although specific safety data should be consulted for handling and usage. Its applications can extend to fields such as pharmaceuticals, agrochemicals, and materials science, where it may play a role in the development of new compounds or materials.
Formula:C5H11N3Si
InChI:InChI=1S/C5H11N3Si/c1-9(2,3)8-5-6-4-7-8/h4-5H,1-3H3
InChI key:InChIKey=WPSPBNRWECRRPK-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)N1C=NC=N1
Synonyms:
  • 1-(3,5-Dichloro-2-Hydroxyphenyl)Propan-1-One
  • 1-(Trimethylsilyl)-1H-1,2,4-triazole
  • 1-(Trimethylsilyl)triazole
  • 1H-1,2,4-Triazole, 1-(trimethylsilyl)-
  • N-(Trimethylsilyl)triazole
  • 1-Trimethylsilyl-1,2,4-triazole
Found 4 products.