CymitQuimica logo

CAS 18304-79-5

:

1,3,6,8-Tetraazatricyclo[6.2.1.13,6]dodecane

Description:
1,3,6,8-Tetraazatricyclo[6.2.1.13,6]dodecane, with the CAS number 18304-79-5, is a polycyclic compound characterized by its unique tricyclic structure that incorporates four nitrogen atoms within its framework. This compound belongs to the class of azabicyclic compounds, which are known for their potential applications in various fields, including medicinal chemistry and materials science. The presence of multiple nitrogen atoms contributes to its basicity and potential coordination properties, making it of interest for complexation with metal ions. Additionally, the rigid structure of the molecule may influence its reactivity and interaction with biological systems. The compound is typically synthesized through multi-step organic reactions, and its stability can vary depending on environmental conditions. Due to its complex structure, 1,3,6,8-Tetraazatricyclo[6.2.1.13,6]dodecane may exhibit interesting physical and chemical properties, such as solubility in polar solvents and potential for forming derivatives that could enhance its functionality in various applications.
Formula:C8H16N4
InChI:InChI=1S/C8H16N4/c1-2-10-5-9(1)7-11-3-4-12(6-11)8-10/h1-8H2
InChI key:InChIKey=ZBFHXDNNFOOFLY-UHFFFAOYSA-N
SMILES:N12CN3CN(CN(C1)CC2)CC3
Synonyms:
  • 1,3,6,8-Tetraazatricyclo(6.2.1.13,6)dodecane, stereoisomer
  • 1,3,6,8-tetraazatricyclo[6.2.1.1~3,6~]dodecane
  • NSC 4436
  • Dimtac
  • 1,3,6,8-Diendomethylene-1,3,6,8-tetraazacyclodecane
  • 1,3,6,8-Tetraazatricyclo[6.2.1.13,6]dodecane
  • 1,3,6,8-Tetraazatricyclo(6.2.1.13,6)dodecane
Found 2 products.