CymitQuimica logo

CAS 183158-30-7

:

3-(tert-Butylaminocarbonyl)phenylboronic acid

Description:
3-(tert-Butylaminocarbonyl)phenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring, which is further substituted with a tert-butylaminocarbonyl group. This compound typically exhibits properties associated with both boronic acids and amides, including the ability to form reversible covalent bonds with diols, making it useful in various applications such as drug development and organic synthesis. The tert-butyl group contributes to its steric bulk, influencing its reactivity and solubility in organic solvents. Additionally, the presence of the boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, a key method in forming carbon-carbon bonds in organic chemistry. The compound is likely to be solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure and functional groups make it a valuable intermediate in the synthesis of more complex molecules in medicinal chemistry and materials science.
Formula:C11H16BNO3
InChI:InChI=1/C11H16BNO3/c1-11(2,3)13-10(14)8-5-4-6-9(7-8)12(15)16/h4-7,15-16H,1-3H3,(H,13,14)
InChI key:MAFLCTFKZXDGGQ-UHFFFAOYSA-N
SMILES:CC(C)(C)N=C(c1cccc(c1)B(O)O)O
Synonyms:
  • [3-(Tert-Butylcarbamoyl)Phenyl]Boronic Acid
Found 3 products.