CymitQuimica logo

CAS 183182-07-2

:

(R)-3-Amino-2-Benzylpropanoic Acid

Description:
(R)-3-Amino-2-benzylpropanoic acid is an amino acid derivative characterized by its chiral center, which imparts specific stereochemical properties. This compound features a propanoic acid backbone with an amino group and a benzyl substituent, contributing to its unique reactivity and solubility characteristics. The presence of the amino group allows it to participate in various chemical reactions, including peptide bond formation, making it relevant in the synthesis of peptides and proteins. Its benzyl group enhances hydrophobic interactions, influencing its behavior in biological systems and potential applications in pharmaceuticals. The compound is typically soluble in polar solvents, and its chirality can affect its biological activity, making it important in drug design and development. Additionally, (R)-3-amino-2-benzylpropanoic acid may exhibit specific interactions with biological receptors, which can be leveraged in medicinal chemistry. Overall, this compound serves as a valuable building block in organic synthesis and has implications in various fields, including biochemistry and pharmacology.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c11-7-9(10(12)13)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m1/s1
InChI key:DJYVEBBGKNAHKE-SECBINFHSA-N
SMILES:C1=CC=C(C=C1)C[C@H](CN)C(=O)O
Found 3 products.