
CAS 183208-58-4
:1-(2-Bromoethyl)-1H-pyrrolo[2,3-b]pyridine
Description:
1-(2-Bromoethyl)-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its unique structure, which includes a pyrrolopyridine core with a bromoethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the bromine atom introduces a halogen functionality, which can enhance its reactivity in nucleophilic substitution reactions. Additionally, the pyrrolo[2,3-b]pyridine framework may impart specific electronic properties, making it of interest in medicinal chemistry and material science. The compound is likely to be a solid at room temperature and may have moderate solubility in organic solvents. Its applications could range from pharmaceutical development to serving as an intermediate in organic synthesis. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact. Always refer to safety data sheets and conduct thorough risk assessments when handling such substances.
Formula:C9H9BrN2
InChI:InChI=1S/C9H9BrN2/c10-4-7-12-6-3-8-2-1-5-11-9(8)12/h1-3,5-6H,4,7H2
InChI key:InChIKey=XXDLBQSNCHTELP-UHFFFAOYSA-N
SMILES:C(CBr)N1C=2C(C=C1)=CC=CN2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 1-(2-bromoethyl)-
- 1-(2-Bromoethyl)-1H-pyrrolo[2,3-b]pyridine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
