CAS 1832578-30-9

Urea, N-[2-chloro-7-[(1R,2R)-1,2-dimethoxypropyl]pyrazolo[1,5-a]pyrimidin-6-yl]-N'-[5-chloro-6-(2H-1,2,3-triazol-2-yl)-3-pyridinyl]-

Description:

The chemical substance known as Urea, N-[2-chloro-7-[(1R,2R)-1,2-dimethoxypropyl]pyrazolo[1,5-a]pyrimidin-6-yl]-N'-[5-chloro-6-(2H-1,2,3-triazol-2-yl)-3-pyridinyl]- is a complex organic compound characterized by its multi-functional structure, which includes a urea moiety and various heterocyclic components. The presence of chlorine atoms and a triazole ring suggests potential biological activity, possibly as a pharmaceutical agent. The compound's stereochemistry, indicated by the (1R,2R) configuration, may influence its interaction with biological targets, affecting its efficacy and safety profile. Additionally, the dimethoxypropyl group and the pyrazolo-pyrimidine structure contribute to its solubility and reactivity. This compound is likely to be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its CAS number, 1832578-30-9, allows for precise identification in chemical databases, facilitating research and development efforts. As with any chemical substance, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₁₉H₁₉Cl₂N₉O₃

InChI: InChI=1S/C19H19Cl2N9O3/c1-10(32-2)17(33-3)16-13(9-22-15-7-14(21)28-29(15)16)27-19(31)26-11-6-12(20)18(23-8-11)30-24-4-5-25-30/h4-10,17H,1-3H3,(H2,26,27,31)/t10-,17+/m1/s1

InChI key: XKQLNDPUQSZBJW-QGHHPUGFSA-N

SMILES: C[C@H]([C@@H](C1=C(C=NC2=CC(=NN21)Cl)NC(=O)NC3=CC(=C(N=C3)N4N=CC=N4)Cl)OC)OC

Synonyms:

• Urea, N-[2-chloro-7-[(1R,2R)-1,2-dimethoxypropyl]pyrazolo[1,5-a]pyrimidin-6-yl]-N'-[5-chloro-6-(2H-1,2,3-triazol-2-yl)-3-pyridinyl]-
• MLT-748

MLT-748

CAS: 1832578-30-9

MLT-748

Formula: C₁₉H₁₉Cl₂N₉O₃

Purity: ≥98%

Molecular weight: 492.32

Ref: 54-BUP05486

MLT-748

CAS: 1832578-30-9

Formula: C₁₉H₁₉Cl₂N₉O₃

Purity: 99%

Molecular weight: 492.3187

Ref: IN-DA01V4E3

MLT-748

CAS: 1832578-30-9

MLT-748 is an effective, selective, and allosteric MALT1 inhibitor. It binds MALT1 in the allosteric Trp580 pocket (IC50: 5 nM).

Formula: C₁₉H₁₉Cl₂N₉O₃

Purity: 99.20%

Color and Shape: Solid

Molecular weight: 492.319

Ref: TM-T16120

MLT 748

CAS: 1832578-30-9

Allosteric inhibitor of MALT1 paracaspase

Formula: C₁₉H₁₉Cl₂N₉O₃

Purity: Min. 95%

Molecular weight: 492.32 g/mol

Ref: 3D-BM168513