CAS 18329-78-7

1H-imidazole-5-carbohydrazide

Description:

1H-imidazole-5-carbohydrazide, with the CAS number 18329-78-7, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a hydrazide functional group, which contributes to its reactivity and potential applications in various chemical reactions. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, and may exhibit moderate stability under standard conditions. The presence of both the imidazole and hydrazide functionalities allows for diverse chemical behavior, including potential roles in coordination chemistry and as a building block in the synthesis of more complex molecules. Additionally, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₄H₆N₄O

InChI: InChI=1/C4H6N4O/c5-8-4(9)3-1-6-2-7-3/h1-2H,5H2,(H,6,7)(H,8,9)

InChI key: FYMACJSAHLBMHV-UHFFFAOYSA-N

SMILES: c1c(C(=NN)O)[nH]cn1

Synonyms:

• 1H-imidazole-4-carbohydrazide
• 1H-imidazole-4-carboxylic acid, hydrazide

1H-Imidazole-4-carbohydrazide

CAS: 18329-78-7

Formula: C₄H₆N₄O

Molecular weight: 126.1166

Ref: IN-DA0027HF

1H-Imidazole-5-carbohydrazide

CAS: 18329-78-7

Versatile small molecule scaffold

Formula: C₄H₆N₄O

Purity: Min. 95%

Molecular weight: 126.12 g/mol

Ref: 3D-TAA32978