CAS 183321-74-6: Erlotinib
Description:Erlotinib is a small molecule tyrosine kinase inhibitor primarily used in the treatment of non-small cell lung cancer (NSCLC) and pancreatic cancer. It specifically targets the epidermal growth factor receptor (EGFR), which is often overexpressed in various tumors, leading to uncontrolled cell proliferation. Erlotinib is characterized by its ability to inhibit the phosphorylation of EGFR, thereby blocking downstream signaling pathways that promote tumor growth and survival. The compound is typically administered orally and has a relatively high bioavailability. Its chemical structure includes a quinazoline core, which is essential for its activity, and it exhibits a moderate to high affinity for the EGFR tyrosine kinase domain. Common side effects associated with erlotinib treatment include rash, diarrhea, and potential liver enzyme elevation. Due to its mechanism of action, erlotinib is often used in patients with specific EGFR mutations, making it a targeted therapy in oncology. As with all medications, its use should be guided by a healthcare professional, considering the patient's overall health and specific cancer characteristics.
Formula:C22H23N3O4
InChI:InChI=1S/C22H23N3O4/c1-4-16-6-5-7-17(12-16)25-22-18-13-20(28-10-8-26-2)21(29-11-9-27-3)14-19(18)23-15-24-22/h1,5-7,12-15H,8-11H2,2-3H3,(H,23,24,25)
InChI key:InChIKey=AAKJLRGGTJKAMG-UHFFFAOYSA-N
SMILES:C#CC1=CC=CC(=C1)NC=2N=CN=C3C=C(OCCOC)C(OCCOC)=CC32
- Synonyms:
- 4-Quinazolinamine, N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)-
- 4-[(3-Ethynylphenyl)Amino]-6,7-Bis(2-Methoxyethoxy)Quinazoline
- Erlotinib & its intermediates (Developing)
- Erlotinib Base
- Erlotinin
- N-(3-Ethynylphenyl)-6,7-bis(2-methoxyethoxy)-4-quinazolinamine
- N-(3-Ethynylphenyl)[6,7-Bis(2-Methoxyethoxy)Quinazolin-4-Yl]Amine
- NSC 718781
- Osi 744
- R 1415
- See more synonyms
- Erlotinib
