CymitQuimica logo

CAS 183322-45-4

:

4-Quinazolinamine, N-(3-bromophenyl)-6,7-dimethoxy-, hydrochloride (1:1)

Description:
4-Quinazolinamine, N-(3-bromophenyl)-6,7-dimethoxy-, hydrochloride (1:1) is a chemical compound characterized by its quinazolinamine core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. The presence of the N-(3-bromophenyl) substituent indicates that a bromine atom is attached to a phenyl group at the 3-position, contributing to its potential biological activity. The 6,7-dimethoxy groups suggest the presence of methoxy (-OCH3) functional groups at the 6 and 7 positions of the quinazolinamine ring, which can influence the compound's solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific interactions and effects would depend on its molecular structure and the presence of functional groups, which can affect its binding affinity and biological activity.
Formula:C16H14BrN3O2·ClH
InChI:InChI=1S/C16H14BrN3O2.ClH/c1-21-14-7-12-13(8-15(14)22-2)18-9-19-16(12)20-11-5-3-4-10(17)6-11;/h3-9H,1-2H3,(H,18,19,20);1H
InChI key:InChIKey=ZJOKWAWPAPMNIM-UHFFFAOYSA-N
SMILES:N(C=1C2=C(C=C(OC)C(OC)=C2)N=CN1)C3=CC(Br)=CC=C3.Cl
Synonyms:
  • 4-Quinazolinamine, N-(3-bromophenyl)-6,7-dimethoxy-, hydrochloride (1:1)
  • 6,7-Dimethoxy-4-[N-(3-bromophenyl)amino]quinazoline hydrochloride
  • PD153035 HCl
  • 4-Quinazolinamine, N-(3-bromophenyl)-6,7-dimethoxy-, monohydrochloride
Found 6 products.