
CAS 18349-96-7
:1-Ethoxy-3-phenoxy-2-propanol
Description:
1-Ethoxy-3-phenoxy-2-propanol, with the CAS number 18349-96-7, is an organic compound characterized by its ether and alcohol functional groups. It features a propanol backbone with an ethoxy group and a phenoxy group attached, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid, exhibiting moderate solubility in water due to the presence of the hydroxyl (-OH) group, while also being soluble in organic solvents. Its molecular structure allows for potential applications in various fields, including as a solvent, surfactant, or intermediate in organic synthesis. The presence of both ethoxy and phenoxy groups may impart specific reactivity and interaction characteristics, making it useful in formulations for coatings, adhesives, or personal care products. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.
Formula:C11H16O3
InChI:InChI=1S/C11H16O3/c1-2-13-8-10(12)9-14-11-6-4-3-5-7-11/h3-7,10,12H,2,8-9H2,1H3
InChI key:InChIKey=TYRUSIJKQXMLLQ-UHFFFAOYSA-N
SMILES:O(CC(COCC)O)C1=CC=CC=C1
Synonyms:- 1-Ethoxy-3-phenoxy-2-propanol
- 3-Phenoxy-1-ethoxy-2-propanol
- 2-Propanol, 1-ethoxy-3-phenoxy-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
