CymitQuimica logo

CAS 183506-73-2

:

1,2,3,6-TETRA-O-ACETYL-4-DEOXY-4-FLUORO-D-GALACTOPYRANOSE

Description:
1,2,3,6-Tetra-O-acetyl-4-deoxy-4-fluoro-D-galactopyranose is a synthetic derivative of galactose, characterized by the presence of four acetyl groups and a fluorine atom at the 4-position of the sugar ring. This compound is typically a white to off-white solid, soluble in organic solvents such as dichloromethane and methanol, but less soluble in water due to its acetylation. The acetyl groups enhance its stability and lipophilicity, making it useful in various chemical reactions and applications, particularly in carbohydrate chemistry and medicinal chemistry. The introduction of the fluorine atom can modify the biological activity and properties of the sugar, potentially influencing its interaction with biological systems. This compound is often utilized in the synthesis of glycosides and other carbohydrate derivatives, serving as an important intermediate in the development of pharmaceuticals and other bioactive molecules. Its unique structural features make it a valuable compound for research in glycoscience and related fields.
Formula:C14H19FO9
InChI:InChI=1S/C14H19FO9/c1-6(16)20-5-10-11(15)12(21-7(2)17)13(22-8(3)18)14(24-10)23-9(4)19/h10-14H,5H2,1-4H3/t10-,11+,12+,13-,14?/m1/s1
InChI key:DPGJKBANJUBLLX-RRYROLNDSA-N
SMILES:CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)OC(=O)C)OC(=O)C)OC(=O)C)F
Found 5 products.