CymitQuimica logo

CAS 1836-27-7

:

Benzamide, 4-bromo-N-hydroxy-

Description:
Benzamide, 4-bromo-N-hydroxy- is an organic compound characterized by the presence of a benzamide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH2) group. The "4-bromo" designation indicates that a bromine atom is substituted at the para position relative to the amide group on the benzene ring. The "N-hydroxy" part signifies that there is a hydroxyl group (OH) attached to the nitrogen atom of the amide. This compound is typically a white to off-white solid and is soluble in polar solvents. It exhibits properties typical of amides, such as the ability to form hydrogen bonds, which can influence its reactivity and interactions with other molecules. Benzamide derivatives are often studied for their biological activity, including potential pharmaceutical applications. The compound's CAS number, 1836-27-7, uniquely identifies it in chemical databases, facilitating research and regulatory compliance.
Formula:C7H6BrNO2
InChI:InChI=1S/C7H6BrNO2/c8-6-3-1-5(2-4-6)7(10)9-11/h1-4,11H,(H,9,10)
InChI key:VESPFSJNQMGUCQ-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(=O)NO)Br
Found 3 products.