CymitQuimica logo

CAS 18370-10-0

:

Benzamide, 3-chloro-N-methyl-

Description:
Benzamide, 3-chloro-N-methyl- is an organic compound characterized by the presence of a benzamide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH) group. The "3-chloro" designation indicates that a chlorine atom is substituted at the third position of the benzene ring, while "N-methyl" signifies that a methyl group (–CH3) is attached to the nitrogen atom of the amide. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the amide and halogen functional groups. It may participate in various chemical reactions, including nucleophilic substitutions and acylation reactions. Benzamide derivatives are often studied for their biological activities and applications in pharmaceuticals, agrochemicals, and materials science. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C8H8ClNO
InChI:InChI=1S/C8H8ClNO/c1-10-8(11)6-3-2-4-7(9)5-6/h2-5H,1H3,(H,10,11)
InChI key:WJJLGPQRUCWHKZ-UHFFFAOYSA-N
SMILES:CNC(=O)C1=CC(=CC=C1)Cl
Found 2 products.