CAS 183721-15-5

mrs-1220

Description:

MRS-1220, with the CAS number 183721-15-5, is a chemical compound that belongs to the class of selective serotonin receptor antagonists. It is primarily known for its role in pharmacological research, particularly in the study of serotonin receptors and their implications in various neurological and psychiatric conditions. MRS-1220 exhibits high affinity for specific serotonin receptor subtypes, making it a valuable tool in understanding serotonin's role in the central nervous system. The compound is typically characterized by its ability to modulate neurotransmitter activity, which can influence mood, anxiety, and other behavioral responses. In laboratory settings, MRS-1220 is often utilized in assays to investigate receptor interactions and the effects of serotonin modulation. As with many research chemicals, safety and handling precautions are essential, as the compound may have specific toxicity profiles or require careful dosing in experimental applications. Overall, MRS-1220 serves as an important compound in the field of neuropharmacology.

Formula: C₂₁H₁₄ClN₅O₂

InChI: InChI=1/C21H14ClN5O2/c22-14-8-9-16-15(12-14)20-25-19(17-7-4-10-29-17)26-27(20)21(23-16)24-18(28)11-13-5-2-1-3-6-13/h1-10,12H,11H2,(H,23,24,28)

SMILES: c1ccc(cc1)CC(=Nc1nc2ccc(cc2c2nc(c3ccco3)nn12)Cl)O

Synonyms:

• N-(9-chloro-2-furan-2-yl[1,2,4]triazolo[1,5-c]quinazolin-5-yl)-2-phenylacetamide

MRS1220

CAS: 183721-15-5

MRS1220

Formula: C₂₁H₁₄ClN₅O₂

Purity: ≥95%

Molecular weight: 403.82

Ref: 54-BUP01164

9-CHLORO-2-(2-FURANYL)-5-[(PHENYLACETY)AMINO][1,2,4]-TRIAZOLO[1,5-C] QUINAZOLINE

CAS: 183721-15-5

Formula: C₂₁H₁₄ClN₅O₂

Purity: 98.43%

Color and Shape: Solid

Molecular weight: 403.8212

Ref: IN-DA00AEBM

MRS 1220

CAS: 183721-15-5

Antagonist of adenosine receptor A3

Formula: C₂₁H₁₄ClN₅O₂

Purity: Min. 95%

Molecular weight: 403.82 g/mol

Ref: 3D-FM30704

MRS1220

CAS: 183721-15-5

MRS1220, a selective and potent antagonist for the human A3 adenosine receptor (hA3AR) with a dissociation constant (Ki) of 0.59 nM, exhibits therapeutic

Formula: C₂₁H₁₄ClN₅O₂

Purity: 98.43%

Color and Shape: Solid

Molecular weight: 403.82

Ref: TM-T23016