CymitQuimica logo

CAS 18385-68-7

:

5-methyl-3,4-dihydro-2H-1-benzopyran-4-one

Description:
5-Methyl-3,4-dihydro-2H-1-benzopyran-4-one, also known by its CAS number 18385-68-7, is a chemical compound characterized by its bicyclic structure, which includes a benzopyran moiety. This compound features a methyl group at the 5-position and a carbonyl group at the 4-position, contributing to its reactivity and potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the dihydro group indicates that it has a saturated ring system, which can influence its stability and solubility in various solvents. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and natural product synthesis. Its derivatives and analogs are often studied for their potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or antioxidant agents. As with many organic compounds, its behavior in reactions can be influenced by factors such as temperature, pH, and the presence of catalysts.
Formula:C10H10O2
InChI:InChI=1/C10H10O2/c1-7-3-2-4-9-10(7)8(11)5-6-12-9/h2-4H,5-6H2,1H3
InChI key:ZFVQMWINGWSVPO-UHFFFAOYSA-N
SMILES:Cc1cccc2c1C(=O)CCO2
Synonyms:
  • 4H-1-benzopyran-4-one, 2,3-dihydro-5-methyl-
  • 5-Methyl-2,3-dihydro-4H-chromen-4-one
  • 5-Methylchroman-4-One
Found 4 products.