CymitQuimica logo

CAS 18385-87-0

:

6-bromo-2H-chromene

Description:
6-Bromo-2H-chromene is an organic compound characterized by its chromene structure, which consists of a benzene ring fused to a pyran ring. The presence of a bromine atom at the 6-position of the chromene framework influences its chemical reactivity and physical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane. Its molecular structure allows for potential applications in various fields, including pharmaceuticals and materials science, due to its ability to participate in electrophilic aromatic substitution reactions. Additionally, 6-bromo-2H-chromene may exhibit biological activity, making it of interest in medicinal chemistry for the development of new therapeutic agents. The compound's CAS number, 18385-87-0, serves as a unique identifier in chemical databases, facilitating its identification and study in research and industrial applications. Overall, 6-bromo-2H-chromene is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C9H7BrO
InChI:InChI=1/C9H7BrO/c10-8-3-4-9-7(6-8)2-1-5-11-9/h1-4,6H,5H2
InChI key:YTNWANXDKHOVBF-UHFFFAOYSA-N
SMILES:C1=Cc2cc(ccc2OC1)Br
Synonyms:
  • 2H-1-benzopyran, 6-bromo-
  • 6-Bromo-2H-chromene
Found 2 products.