CymitQuimica logo

CAS 1840-27-3

:

4-Fluoro-3,5-dimethylaniline

Description:
4-Fluoro-3,5-dimethylaniline, with the CAS number 1840-27-3, is an aromatic amine characterized by the presence of a fluorine atom and two methyl groups attached to a benzene ring. This compound features a primary amine functional group (-NH2), which contributes to its reactivity and potential applications in organic synthesis and dye manufacturing. The fluorine substituent enhances the compound's electronic properties, potentially influencing its reactivity and solubility. The methyl groups at the 3 and 5 positions provide steric hindrance, which can affect the compound's interaction with other molecules. 4-Fluoro-3,5-dimethylaniline is typically a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling. It is important to consider its environmental impact and regulatory status, as many aromatic amines are subject to scrutiny due to their potential health hazards. Overall, this compound is of interest in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its unique structural features and reactivity.
Formula:C8H10FN
InChI:InChI=1S/C8H10FN/c1-5-3-7(10)4-6(2)8(5)9/h3-4H,10H2,1-2H3
InChI key:IGNFILTZSIUWBS-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1F)C)N
Synonyms:
  • 3,5-Dimethyl-4-fluoroaniline
Found 5 products.