CymitQuimica logo

CAS 1841081-83-1

:

2-Pyrimidinemethanol, 4-methyl-, 2-acetate

Description:
2-Pyrimidinemethanol, 4-methyl-, 2-acetate is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a hydroxymethyl group (-CH2OH) at the 2-position and an acetate group (-COOCH3) at the 2-position, along with a methyl group (-CH3) at the 4-position of the pyrimidine ring. The presence of these functional groups contributes to its solubility in polar solvents and influences its reactivity. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the pyrimidine ring. Overall, 2-Pyrimidinemethanol, 4-methyl-, 2-acetate is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-6-3-4-9-8(10-6)5-12-7(2)11/h3-4H,5H2,1-2H3
InChI key:InChIKey=FSFCBKYDFQFQQE-UHFFFAOYSA-N
SMILES:C(OC(C)=O)C=1N=C(C)C=CN1
Synonyms:
  • 2-Pyrimidinemethanol, 4-methyl-, 2-acetate
Found 1 products.