CymitQuimica logo

CAS 184174-80-9

:

4H-Cyclopenta[b]thiophene-3-carboxylic acid, 2-amino-5,6-dihydro-, methyl ester

Description:
4H-Cyclopenta[b]thiophene-3-carboxylic acid, 2-amino-5,6-dihydro-, methyl ester, identified by CAS number 184174-80-9, is a chemical compound characterized by its unique bicyclic structure that incorporates both a thiophene and a cyclopentane ring. This compound features a carboxylic acid functional group and an amino group, which contribute to its potential reactivity and solubility properties. The presence of the methyl ester indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. Its structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the presence of both electron-rich and electron-deficient regions. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, this compound represents a versatile scaffold for further chemical modifications and applications in various fields of chemistry.
Formula:C9H11NO2S
InChI:InChI=1/C9H11NO2S/c1-12-9(11)7-5-3-2-4-6(5)13-8(7)10/h2-4,10H2,1H3
InChI key:XUKGZPUAFGAYHC-UHFFFAOYSA-N
SMILES:COC(=O)c1c2CCCc2sc1N
Synonyms:
  • 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid methyl ester
  • methyl 2-amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate
Found 3 products.