CymitQuimica logo

CAS 18437-79-1

:

Tris(4-fluorophenyl)phosphine

Description:
Tris(4-fluorophenyl)phosphine is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to three 4-fluorophenyl groups. Its molecular structure features a central phosphorus atom surrounded by three aromatic rings, each containing a fluorine substituent at the para position. This substitution enhances the electron-withdrawing properties of the phenyl groups, influencing the compound's reactivity and stability. Tris(4-fluorophenyl)phosphine is typically a white to light yellow solid, and it is soluble in organic solvents such as dichloromethane and tetrahydrofuran. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications as a ligand in coordination chemistry and as a precursor for the synthesis of more complex phosphorus-containing compounds. Additionally, its unique electronic properties make it a candidate for studies in catalysis and organic reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C18H12F3OP
InChI:InChI=1/C18H12F3OP/c19-13-1-7-16(8-2-13)23(22,17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H
InChI key:VSJZSGXKNZYQPR-UHFFFAOYSA-N
SMILES:c1cc(ccc1F)P(=O)(c1ccc(cc1)F)c1ccc(cc1)F
Synonyms:
  • Trisfluorophenylphosphine
  • Trispfluorophenylphosphine
  • Tris(4-Fluorophenyl)Phosphane Oxide
Found 3 products.