CymitQuimica logo

CAS 1844-53-7

:

6-Chloro-2-phenylimidazo[1,2-b]pyridazine

Description:
6-Chloro-2-phenylimidazo[1,2-b]pyridazine, with the CAS number 1844-53-7, is a heterocyclic compound characterized by its imidazo and pyridazine rings, which contribute to its unique chemical properties. This compound typically exhibits a pale yellow to light brown solid appearance and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the chloro group and the phenyl substituent can influence its reactivity and solubility in various solvents. It may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the chlorine atom. Additionally, the imidazo and pyridazine moieties can engage in hydrogen bonding and π-π stacking interactions, which are significant in biological systems. The compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its pharmacological properties, toxicity, and environmental impact are essential for understanding its full potential and safety profile.
Formula:C12H8ClN3
InChI:InChI=1/C12H8ClN3/c13-11-6-7-12-14-10(8-16(12)15-11)9-4-2-1-3-5-9/h1-8H
InChI key:FPWMERDSYDEJOP-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1cn2c(ccc(Cl)n2)n1
Synonyms:
  • Imidazo(1,2-b)pyridazine, 6-chloro-2-phenyl-
Found 2 products.