CymitQuimica logo

CAS 1845690-63-2

:

4-Bromo-N-methyl-2-(methylsulfonyl)benzenamine

Description:
4-Bromo-N-methyl-2-(methylsulfonyl)benzenamine is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a methylsulfonyl group attached to a benzene ring. The presence of the bromine atom introduces notable electrophilic properties, while the methylsulfonyl group contributes to the compound's solubility and reactivity. This compound features an amine functional group, which can participate in hydrogen bonding and may influence its biological activity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both electron-withdrawing and electron-donating groups. Its CAS number, 1845690-63-2, allows for precise identification in chemical databases. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the substance. Safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C8H10BrNO2S
InChI:InChI=1S/C8H10BrNO2S/c1-10-7-4-3-6(9)5-8(7)13(2,11)12/h3-5,10H,1-2H3
InChI key:InChIKey=LEOIGBUTQWWLKO-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(NC)C=CC(Br)=C1
Synonyms:
  • Benzenamine, 4-bromo-N-methyl-2-(methylsulfonyl)-
  • 4-Bromo-N-methyl-2-(methylsulfonyl)benzenamine
Found 1 products.