CymitQuimica logo

CAS 1845693-81-3

:

Benzenamine, 2-bromo-4-fluoro-N-methyl-6-nitro-

Description:
Benzenamine, 2-bromo-4-fluoro-N-methyl-6-nitro- is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with various functional groups. The presence of a bromo group and a fluoro group indicates that it has halogen substituents, which can influence its reactivity and physical properties. The nitro group is a strong electron-withdrawing group, which can enhance the compound's acidity and affect its electrophilic substitution reactions. The N-methyl substitution suggests that the amine group is tertiary, which can impact the compound's solubility and basicity. Overall, this compound is likely to exhibit unique chemical behavior due to the combination of these substituents, making it of interest in various fields such as pharmaceuticals, agrochemicals, and materials science. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from chemical databases for precise applications.
Formula:C7H6BrFN2O2
InChI:InChI=1S/C7H6BrFN2O2/c1-10-7-5(8)2-4(9)3-6(7)11(12)13/h2-3,10H,1H3
InChI key:InChIKey=SRIAGXAZQFWSEI-UHFFFAOYSA-N
SMILES:N(C)C1=C(N(=O)=O)C=C(F)C=C1Br
Synonyms:
  • 2-Bromo-4-fluoro-N-methyl-6-nitrobenzenamine
  • Benzenamine, 2-bromo-4-fluoro-N-methyl-6-nitro-
  • (2-Bromo-4-fluoro-6-nitro-phenyl)-methyl-amine
Found 3 products.