CymitQuimica logo

CAS 184764-63-4

:

1H-Pyrazolo[3,4-d]pyrimidine-4,6(2H,5H)-dione

Description:
1H-Pyrazolo[3,4-d]pyrimidine-4,6(2H,5H)-dione, with the CAS number 184764-63-4, is a heterocyclic compound characterized by its pyrazolo and pyrimidine ring structures. This compound features a fused bicyclic system that includes a pyrazole ring and a pyrimidine ring, contributing to its unique chemical properties. It typically exhibits a solid-state at room temperature and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the dione functional groups indicates that it can participate in various chemical reactions, including hydrogen bonding and nucleophilic attacks. Its molecular structure allows for interactions with biological targets, which may lead to pharmacological applications. Additionally, the compound's stability and solubility can vary depending on the solvent and environmental conditions. Overall, 1H-Pyrazolo[3,4-d]pyrimidine-4,6(2H,5H)-dione is a compound of significant interest for research in drug development and synthetic chemistry.
Formula:C5H4N4O2
InChI:InChI=1S/C5H4N4O2/c10-4-2-1-6-9-3(2)7-5(11)8-4/h1H,(H3,6,7,8,9,10,11)
InChI key:HXNFUBHNUDHIGC-UHFFFAOYSA-N
SMILES:C1=NNC2=C1C(=O)NC(=O)N2
Found 1 products.