CAS 1848-69-7
:1-PHENYL-IMIDAZOLIDIN-2-ONE
Description:
1-Phenyl-imidazolidin-2-one, with the CAS number 1848-69-7, is a heterocyclic organic compound characterized by its imidazolidinone structure, which features a five-membered ring containing two nitrogen atoms and a carbonyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. Its molecular structure includes a phenyl group, which contributes to its aromatic properties and potential reactivity. 1-Phenyl-imidazolidin-2-one is known for its applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals and biologically active compounds. The presence of the imidazolidinone moiety can impart unique chemical properties, such as the ability to participate in hydrogen bonding and act as a nucleophile or electrophile in chemical reactions. Additionally, this compound may exhibit interesting biological activities, making it a subject of research in drug development and related fields. Proper handling and storage are essential due to its chemical nature, and safety data sheets should be consulted for specific safety guidelines.
Formula:C9H10N2O
InChI:InChI=1/C9H10N2O/c12-9-10-6-7-11(9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,12)
SMILES:c1ccc(cc1)N1CCN=C1O
Synonyms:- 1-Phenyl-2-imidazolidinon
- 1-Phenyl-2-imidazolidinone
- 1-Phenylimidazolidin-2-one
- 2-Imidazolidinone, 1-Phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Phenylimidazolidin-2-one
CAS:1-Phenylimidazolidin-2-oneFormula:C9H10N2OPurity:98%Color and Shape:SolidMolecular weight:162.18852-Imidazolidinone,1-phenyl-
CAS:Formula:C9H10N2OPurity:95%Color and Shape:SolidMolecular weight:162.18851-Phenylimidazolidin-2-one
CAS:1-Phenylimidazolidin-2-one is a tyrosine kinase inhibitor that belongs to the class of receptor tyrosine kinase inhibitors. It is used in the treatment of hypertension and has been shown to reduce levels of dopamine in the brain. 1-Phenylimidazolidin-2-one binds to tyrosine kinases and blocks their activity, which prevents phosphorylation of proteins involved in neurotransmitter synthesis. This agent also has neuroleptic effects, which may be due to its ability to inhibit dopaminergic receptors.Formula:C9H10N2OPurity:Min. 95%Molecular weight:162.19 g/mol



