CymitQuimica logo

CAS 185-61-5

:

1,5-Dioxaspiro[2.4]heptane

Description:
1,5-Dioxaspiro[2.4]heptane, with the CAS number 185-61-5, is a bicyclic organic compound characterized by its unique spiro structure, which consists of a seven-membered ring fused with a dioxane moiety. This compound features two ether linkages within its structure, contributing to its stability and reactivity. It is typically a colorless liquid or solid at room temperature and is known for its relatively low volatility. The presence of the dioxane ring imparts certain polar characteristics, making it soluble in various organic solvents. 1,5-Dioxaspiro[2.4]heptane is of interest in organic synthesis and materials science due to its potential applications in the development of polymers and other functional materials. Its reactivity can be influenced by the presence of substituents on the spiro framework, allowing for further derivatization. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested.
Formula:C5H8O2
InChI:InChI=1S/C5H8O2/c1-2-6-3-5(1)4-7-5/h1-4H2
InChI key:InChIKey=SNVWCQVCIGRDCF-UHFFFAOYSA-N
SMILES:C12(CO1)CCOC2
Synonyms:
  • 1,5-Dioxaspiro[2.4]heptane
Found 3 products.