CAS 185017-72-5

5-Bromo-6-chloro-2-picoline

Description:

5-Bromo-6-chloro-2-picoline is a heterocyclic organic compound characterized by the presence of both bromine and chlorine substituents on a pyridine ring. It belongs to the class of picolines, which are methylpyridines, and specifically features a bromine atom at the 5-position and a chlorine atom at the 6-position of the pyridine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The presence of halogens in its structure can influence its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 5-Bromo-6-chloro-2-picoline may exhibit biological activity, which can be explored in medicinal chemistry. As with many halogenated compounds, proper handling and safety precautions are essential due to potential toxicity and environmental concerns.

Formula: C₆H₅BrClN

InChI: InChI=1/C6H5BrClN/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3

SMILES: Cc1ccc(c(Cl)n1)Br

Synonyms:

• 3-Bromo-2-chloro-6-methylpyridine
• 3-Bromo-2-Chloro-6-Picoline

3-Bromo-2-chloro-6-picoline

CAS: 185017-72-5

Formula: C₆H₅BrClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 206.4676

Ref: IN-DA0037MZ

3-Bromo-2-chloro-6-methylpyridine

CAS: 185017-72-5

3-Bromo-2-chloro-6-methylpyridine

Purity: 98%

Color and Shape: Powder

Molecular weight: 206.47g/mol

Ref: 54-OR52202

3-Bromo-2-chloro-6-methylpyridine

CAS: 185017-72-5

Formula: C₆H₅BrClN

Purity: 97%

Color and Shape: Solid

Molecular weight: 206.47

Ref: 10-F036228