CymitQuimica logo

CAS 185017-72-5

:

5-Bromo-6-chloro-2-picoline

Description:
5-Bromo-6-chloro-2-picoline is a heterocyclic organic compound characterized by the presence of both bromine and chlorine substituents on a pyridine ring. It belongs to the class of picolines, which are methylpyridines, and specifically features a bromine atom at the 5-position and a chlorine atom at the 6-position of the pyridine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The presence of halogens in its structure can influence its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 5-Bromo-6-chloro-2-picoline may exhibit biological activity, which can be explored in medicinal chemistry. As with many halogenated compounds, proper handling and safety precautions are essential due to potential toxicity and environmental concerns.
Formula:C6H5BrClN
InChI:InChI=1/C6H5BrClN/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3
InChI key:JVDQYSIJBRTRMS-UHFFFAOYSA-N
SMILES:Cc1ccc(c(Cl)n1)Br
Synonyms:
  • 3-Bromo-2-chloro-6-methylpyridine
  • 3-Bromo-2-Chloro-6-Picoline
Found 3 products.